C16H18O3 — CID 765561
(6R)-6-acetyl-3-(4-ethoxyphenyl)cyclohex-2-en-1-one (PubChem CID 765561) has the molecular formula C16H18O3 and a molecular weight of 258.32 g/mol. Its IUPAC name is (6R)-6-acetyl-3-(4-ethoxyphenyl)cyclohex-2-en-1-one.
| Compound Name | (6R)-6-acetyl-3-(4-ethoxyphenyl)cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 765561 |
| Molecular Formula | C16H18O3 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | (6R)-6-acetyl-3-(4-ethoxyphenyl)cyclohex-2-en-1-one |
| SMILES | CCOc1ccc(C2=CC(=O)[C@@H](C(C)=O)CC2)cc1 |
| InChI | InChI=1S/C16H18O3/c1-3-19-14-7-4-12(5-8-14)13-6-9-15(11(2)17)16(18)10-13/h4-5,7-8,10,15H,3,6,9H2,1-2H3/t15-/m1/s1 |
| InChIKey | QEFQHIUJKTVFSA-OAHLLOKOSA-N |
| XLogP | 3.04 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|