C32H43F3N2O2 — CID 76556819
2-[3-benzyl-4-propyl-2-(2,2,2-trifluoroethylimino)pyrrolidin-1-yl]-1-(3,5-ditert-butyl-4-hydroxyphenyl)ethanone (PubChem CID 76556819) has the molecular formula C32H43F3N2O2 and a molecular weight of 544.70 g/mol. Its IUPAC name is 2-[3-benzyl-4-propyl-2-(2,2,2-trifluoroethylimino)pyrrolidin-1-yl]-1-(3,5-ditert-butyl-4-hydroxyphenyl)ethanone.
| Compound Name | 2-[3-benzyl-4-propyl-2-(2,2,2-trifluoroethylimino)pyrrolidin-1-yl]-1-(3,5-ditert-butyl-4-hydroxyphenyl)ethanone |
|---|---|
| PubChem CID | 76556819 |
| Molecular Formula | C32H43F3N2O2 |
| Molecular Weight | 544.70 g/mol |
| Exact Mass | 544.33 |
| IUPAC Name | 2-[3-benzyl-4-propyl-2-(2,2,2-trifluoroethylimino)pyrrolidin-1-yl]-1-(3,5-ditert-butyl-4-hydroxyphenyl)ethanone |
| SMILES | CCCC1CN(CC(=O)c2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)/C(=N/CC(F)(F)F)C1Cc1ccccc1 |
| InChI | InChI=1S/C32H43F3N2O2/c1-8-12-22-18-37(29(36-20-32(33,34)35)24(22)15-21-13-10-9-11-14-21)19-27(38)23-16-25(30(2,3)4)28(39)26(17-23)31(5,6)7/h9-11,13-14,16-17,22,24,39H,8,12,15,18-20H2,1-7H3/b36-29+ |
| InChIKey | BAQKYOKCYQOAMS-ZONNCAFXSA-N |
| XLogP | 7.72 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.70 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|