C35H46N4O2P+ — CID 76559004
2-[3-[2-[3-(1-butyl-3,3-dimethylindol-2-ylidene)prop-1-enyl]-3,3-dimethylindol-1-ium-1-yl]propoxy]-4-methyl-1,3,2-oxazaphosphinane-5-carbonitrile (PubChem CID 76559004) has the molecular formula C35H46N4O2P+ and a molecular weight of 585.75 g/mol. Its IUPAC name is 2-[3-[2-[3-(1-butyl-3,3-dimethylindol-2-ylidene)prop-1-enyl]-3,3-dimethylindol-1-ium-1-yl]propoxy]-4-methyl-1,3,2-oxazaphosphinane-5-carbonitrile.
| Compound Name | 2-[3-[2-[3-(1-butyl-3,3-dimethylindol-2-ylidene)prop-1-enyl]-3,3-dimethylindol-1-ium-1-yl]propoxy]-4-methyl-1,3,2-oxazaphosphinane-5-carbonitrile |
|---|---|
| PubChem CID | 76559004 |
| Molecular Formula | C35H46N4O2P+ |
| Molecular Weight | 585.75 g/mol |
| Exact Mass | 585.34 |
| IUPAC Name | 2-[3-[2-[3-(1-butyl-3,3-dimethylindol-2-ylidene)prop-1-enyl]-3,3-dimethylindol-1-ium-1-yl]propoxy]-4-methyl-1,3,2-oxazaphosphinane-5-carbonitrile |
| SMILES | CCCCN1C(=CC=CC2=[N+](CCCOP3NC(C)C(C#N)CO3)c3ccccc3C2(C)C)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C35H46N4O2P/c1-7-8-21-38-30-17-11-9-15-28(30)34(3,4)32(38)19-13-20-33-35(5,6)29-16-10-12-18-31(29)39(33)22-14-23-40-42-37-26(2)27(24-36)25-41-42/h9-13,15-20,26-27,37H,7-8,14,21-23,25H2,1-6H3/q+1 |
| InChIKey | VEPPDNMSUNKQSJ-UHFFFAOYSA-N |
| XLogP | 7.88 |
| TPSA | 60.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.75 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|