C14H11Cl2N5 — CID 76559990
3-[4-[(3,6-dichloro-1,2,4-triazin-5-yl)amino]-3,5-dimethylphenyl]prop-2-enenitrile (PubChem CID 76559990) has the molecular formula C14H11Cl2N5 and a molecular weight of 320.18 g/mol. Its IUPAC name is 3-[4-[(3,6-dichloro-1,2,4-triazin-5-yl)amino]-3,5-dimethylphenyl]prop-2-enenitrile.
| Compound Name | 3-[4-[(3,6-dichloro-1,2,4-triazin-5-yl)amino]-3,5-dimethylphenyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 76559990 |
| Molecular Formula | C14H11Cl2N5 |
| Molecular Weight | 320.18 g/mol |
| Exact Mass | 319.04 |
| IUPAC Name | 3-[4-[(3,6-dichloro-1,2,4-triazin-5-yl)amino]-3,5-dimethylphenyl]prop-2-enenitrile |
| SMILES | Cc1cc(C=CC#N)cc(C)c1Nc1nc(Cl)nnc1Cl |
| InChI | InChI=1S/C14H11Cl2N5/c1-8-6-10(4-3-5-17)7-9(2)11(8)18-13-12(15)20-21-14(16)19-13/h3-4,6-7H,1-2H3,(H,18,19,21) |
| InChIKey | UWGXDGWUYXSSDV-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.18 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|