About 6-(dimethylamino)-1-methyl-1,3-diazinane-2,4-dione
6-(dimethylamino)-1-methyl-1,3-diazinane-2,4-dione (PubChem CID 76560667) has the molecular formula C7H13N3O2
and a molecular weight of 171.20 g/mol. Its IUPAC name is 6-(dimethylamino)-1-methyl-1,3-diazinane-2,4-dione.
Molecular Properties
| Compound Name | 6-(dimethylamino)-1-methyl-1,3-diazinane-2,4-dione |
| PubChem CID | 76560667 |
| Molecular Formula | C7H13N3O2 |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.10 |
| IUPAC Name | 6-(dimethylamino)-1-methyl-1,3-diazinane-2,4-dione |
| SMILES | CN(C)C1CC(=O)NC(=O)N1C |
| InChI | InChI=1S/C7H13N3O2/c1-9(2)6-4-5(11)8-7(12)10(6)3/h6H,4H2,1-3H3,(H,8,11,12) |
| InChIKey | OGXXNRRDIHVZFE-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-(dimethylamino)-1-methyl-1,3-diazinane-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(dimethylamino)-1-methyl-1,3-diazinane-2,4-dione?
The IUPAC name of 6-(dimethylamino)-1-methyl-1,3-diazinane-2,4-dione (CID 76560667) is 6-(dimethylamino)-1-methyl-1,3-diazinane-2,4-dione.
What is the SMILES notation for 6-(dimethylamino)-1-methyl-1,3-diazinane-2,4-dione?
The canonical SMILES for 6-(dimethylamino)-1-methyl-1,3-diazinane-2,4-dione is CN(C)C1CC(=O)NC(=O)N1C.
What is the InChIKey of 6-(dimethylamino)-1-methyl-1,3-diazinane-2,4-dione?
The InChIKey is OGXXNRRDIHVZFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N3O2/c1-9(2)6-4-5(11)8-7(12)10(6)3/h6H,4H2,1-3H3,(H,8,11,12).
What are the key properties of 6-(dimethylamino)-1-methyl-1,3-diazinane-2,4-dione?
6-(dimethylamino)-1-methyl-1,3-diazinane-2,4-dione has a molecular weight of 171.20 g/mol, XLogP of -0.55, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(dimethylamino)-1-methyl-1,3-diazinane-2,4-dione is sourced from PubChem (CID 76560667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).