C22H28N10O — CID 76562232
1-[4-[N-(diaminomethylideneamino)-C-methylcarbonimidoyl]phenyl]-3-[5-(diaminomethylidenehydrazinylidene)-6-methyl-7,8-dihydro-6H-naphthalen-2-yl]urea (PubChem CID 76562232) has the molecular formula C22H28N10O and a molecular weight of 448.54 g/mol. Its IUPAC name is 1-[4-[N-(diaminomethylideneamino)-C-methylcarbonimidoyl]phenyl]-3-[5-(diaminomethylidenehydrazinylidene)-6-methyl-7,8-dihydro-6H-naphthalen-2-yl]urea.
| Compound Name | 1-[4-[N-(diaminomethylideneamino)-C-methylcarbonimidoyl]phenyl]-3-[5-(diaminomethylidenehydrazinylidene)-6-methyl-7,8-dihydro-6H-naphthalen-2-yl]urea |
|---|---|
| PubChem CID | 76562232 |
| Molecular Formula | C22H28N10O |
| Molecular Weight | 448.54 g/mol |
| Exact Mass | 448.24 |
| IUPAC Name | 1-[4-[N-(diaminomethylideneamino)-C-methylcarbonimidoyl]phenyl]-3-[5-(diaminomethylidenehydrazinylidene)-6-methyl-7,8-dihydro-6H-naphthalen-2-yl]urea |
| SMILES | CC(=NN=C(N)N)c1ccc(NC(=O)Nc2ccc3c(c2)CCC(C)C3=NN=C(N)N)cc1 |
| InChI | InChI=1S/C22H28N10O/c1-12-3-4-15-11-17(9-10-18(15)19(12)30-32-21(25)26)28-22(33)27-16-7-5-14(6-8-16)13(2)29-31-20(23)24/h5-12H,3-4H2,1-2H3,(H4,23,24,31)(H4,25,26,32)(H2,27,28,33) |
| InChIKey | PTYXZWKQTVWFOY-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 194.65 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.54 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|