C54H30Br4F12 — CID 76563619
1,4-dibromo-2,5-bis[2-bromo-4,5-bis[2-[4-(trifluoromethyl)phenyl]ethenyl]phenyl]benzene (PubChem CID 76563619) has the molecular formula C54H30Br4F12 and a molecular weight of 1226.43 g/mol. Its IUPAC name is 1,4-dibromo-2,5-bis[2-bromo-4,5-bis[2-[4-(trifluoromethyl)phenyl]ethenyl]phenyl]benzene.
| Compound Name | 1,4-dibromo-2,5-bis[2-bromo-4,5-bis[2-[4-(trifluoromethyl)phenyl]ethenyl]phenyl]benzene |
|---|---|
| PubChem CID | 76563619 |
| Molecular Formula | C54H30Br4F12 |
| Molecular Weight | 1226.43 g/mol |
| Exact Mass | 1221.89 |
| IUPAC Name | 1,4-dibromo-2,5-bis[2-bromo-4,5-bis[2-[4-(trifluoromethyl)phenyl]ethenyl]phenyl]benzene |
| SMILES | FC(F)(F)c1ccc(C=Cc2cc(Br)c(-c3cc(Br)c(-c4cc(C=Cc5ccc(C(F)(F)F)cc5)c(C=Cc5ccc(C(F)(F)F)cc5)cc4Br)cc3Br)cc2C=Cc2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C54H30Br4F12/c55-47-27-37(15-3-33-9-21-41(22-10-33)53(65,66)67)35(13-1-31-5-17-39(18-6-31)51(59,60)61)25-43(47)45-29-50(58)46(30-49(45)57)44-26-36(14-2-32-7-19-40(20-8-32)52(62,63)64)38(28-48(44)56)16-4-34-11-23-42(24-12-34)54(68,69)70/h1-30H |
| InChIKey | FZMOSOYOLYKOGN-UHFFFAOYSA-N |
| XLogP | 20.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1226.43 |
| LogP ≤ 5 | 20.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|