About 8-(benzhydrylideneamino)-5-methoxy-N,N-dimethyl-3,4-dihydro-2H-chromen-3-amine
8-(benzhydrylideneamino)-5-methoxy-N,N-dimethyl-3,4-dihydro-2H-chromen-3-amine (PubChem CID 76565019) has the molecular formula C25H26N2O2
and a molecular weight of 386.50 g/mol. Its IUPAC name is 8-(benzhydrylideneamino)-5-methoxy-N,N-dimethyl-3,4-dihydro-2H-chromen-3-amine.
Molecular Properties
| Compound Name | 8-(benzhydrylideneamino)-5-methoxy-N,N-dimethyl-3,4-dihydro-2H-chromen-3-amine |
| PubChem CID | 76565019 |
| Molecular Formula | C25H26N2O2 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | 8-(benzhydrylideneamino)-5-methoxy-N,N-dimethyl-3,4-dihydro-2H-chromen-3-amine |
| SMILES | COc1ccc(N=C(c2ccccc2)c2ccccc2)c2c1CC(N(C)C)CO2 |
| InChI | InChI=1S/C25H26N2O2/c1-27(2)20-16-21-23(28-3)15-14-22(25(21)29-17-20)26-24(18-10-6-4-7-11-18)19-12-8-5-9-13-19/h4-15,20H,16-17H2,1-3H3 |
| InChIKey | KXJBFCAPRZHRGV-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 8-(benzhydrylideneamino)-5-methoxy-N,N-dimethyl-3,4-dihydro-2H-chromen-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(benzhydrylideneamino)-5-methoxy-N,N-dimethyl-3,4-dihydro-2H-chromen-3-amine?
The IUPAC name of 8-(benzhydrylideneamino)-5-methoxy-N,N-dimethyl-3,4-dihydro-2H-chromen-3-amine (CID 76565019) is 8-(benzhydrylideneamino)-5-methoxy-N,N-dimethyl-3,4-dihydro-2H-chromen-3-amine.
What is the SMILES notation for 8-(benzhydrylideneamino)-5-methoxy-N,N-dimethyl-3,4-dihydro-2H-chromen-3-amine?
The canonical SMILES for 8-(benzhydrylideneamino)-5-methoxy-N,N-dimethyl-3,4-dihydro-2H-chromen-3-amine is COc1ccc(N=C(c2ccccc2)c2ccccc2)c2c1CC(N(C)C)CO2.
What is the InChIKey of 8-(benzhydrylideneamino)-5-methoxy-N,N-dimethyl-3,4-dihydro-2H-chromen-3-amine?
The InChIKey is KXJBFCAPRZHRGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H26N2O2/c1-27(2)20-16-21-23(28-3)15-14-22(25(21)29-17-20)26-24(18-10-6-4-7-11-18)19-12-8-5-9-13-19/h4-15,20H,16-17H2,1-3H3.
What are the key properties of 8-(benzhydrylideneamino)-5-methoxy-N,N-dimethyl-3,4-dihydro-2H-chromen-3-amine?
8-(benzhydrylideneamino)-5-methoxy-N,N-dimethyl-3,4-dihydro-2H-chromen-3-amine has a molecular weight of 386.50 g/mol, XLogP of 4.73, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(benzhydrylideneamino)-5-methoxy-N,N-dimethyl-3,4-dihydro-2H-chromen-3-amine is sourced from PubChem (CID 76565019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).