C36H33N2O5S+ — CID 76566048
3-[6-[[7-[(1-ethylbenzo[e][1,3]benzoxazol-1-ium-2-yl)methylidene]-4,4a,5,6-tetrahydro-3H-naphthalen-2-yl]methylidene]-[1,3]dioxolo[4,5-f][1,3]benzothiazol-7-yl]propanoic acid (PubChem CID 76566048) has the molecular formula C36H33N2O5S+ and a molecular weight of 605.74 g/mol. Its IUPAC name is 3-[6-[[7-[(1-ethylbenzo[e][1,3]benzoxazol-1-ium-2-yl)methylidene]-4,4a,5,6-tetrahydro-3H-naphthalen-2-yl]methylidene]-[1,3]dioxolo[4,5-f][1,3]benzothiazol-7-yl]propanoic acid.
| Compound Name | 3-[6-[[7-[(1-ethylbenzo[e][1,3]benzoxazol-1-ium-2-yl)methylidene]-4,4a,5,6-tetrahydro-3H-naphthalen-2-yl]methylidene]-[1,3]dioxolo[4,5-f][1,3]benzothiazol-7-yl]propanoic acid |
|---|---|
| PubChem CID | 76566048 |
| Molecular Formula | C36H33N2O5S+ |
| Molecular Weight | 605.74 g/mol |
| Exact Mass | 605.21 |
| IUPAC Name | 3-[6-[[7-[(1-ethylbenzo[e][1,3]benzoxazol-1-ium-2-yl)methylidene]-4,4a,5,6-tetrahydro-3H-naphthalen-2-yl]methylidene]-[1,3]dioxolo[4,5-f][1,3]benzothiazol-7-yl]propanoic acid |
| SMILES | CC[n+]1c(C=C2C=C3C=C(C=C4Sc5cc6c(cc5N4CCC(=O)O)OCO6)CCC3CC2)oc2ccc3ccccc3c21 |
| InChI | InChI=1S/C36H32N2O5S/c1-2-37-33(43-29-12-11-25-5-3-4-6-27(25)36(29)37)17-22-7-9-24-10-8-23(16-26(24)15-22)18-34-38(14-13-35(39)40)28-19-30-31(42-21-41-30)20-32(28)44-34/h3-6,11-12,15-20,24H,2,7-10,13-14,21H2,1H3/p+1 |
| InChIKey | JPDXRGCZSRUEFJ-UHFFFAOYSA-O |
| XLogP | 7.99 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.74 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|