C14H12F15NO3 — CID 76569348
2,3-dimethyl-4-oxo-4-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctylamino)butanoic acid (PubChem CID 76569348) has the molecular formula C14H12F15NO3 and a molecular weight of 527.22 g/mol. Its IUPAC name is 2,3-dimethyl-4-oxo-4-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctylamino)butanoic acid.
| Compound Name | 2,3-dimethyl-4-oxo-4-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctylamino)butanoic acid |
|---|---|
| PubChem CID | 76569348 |
| Molecular Formula | C14H12F15NO3 |
| Molecular Weight | 527.22 g/mol |
| Exact Mass | 527.06 |
| IUPAC Name | 2,3-dimethyl-4-oxo-4-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctylamino)butanoic acid |
| SMILES | CC(C(=O)O)C(C)C(=O)NCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H12F15NO3/c1-4(5(2)7(32)33)6(31)30-3-8(15,16)9(17,18)10(19,20)11(21,22)12(23,24)13(25,26)14(27,28)29/h4-5H,3H2,1-2H3,(H,30,31)(H,32,33) |
| InChIKey | BQEPLBIAQMNMKN-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.22 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|