C40H44O2S4 — CID 76569383
2,8-bis[3-methyl-5-(3-methylthiophen-2-yl)thiophen-2-yl]-1,2,3,4,4a,4b,5,5a,6a,7,8,9,10,10a,10b,11,11a,12a-octadecahydroindeno[1,2-b]fluorene-6,12-dione (PubChem CID 76569383) has the molecular formula C40H44O2S4 and a molecular weight of 685.06 g/mol. Its IUPAC name is 2,8-bis[3-methyl-5-(3-methylthiophen-2-yl)thiophen-2-yl]-1,2,3,4,4a,4b,5,5a,6a,7,8,9,10,10a,10b,11,11a,12a-octadecahydroindeno[1,2-b]fluorene-6,12-dione.
| Compound Name | 2,8-bis[3-methyl-5-(3-methylthiophen-2-yl)thiophen-2-yl]-1,2,3,4,4a,4b,5,5a,6a,7,8,9,10,10a,10b,11,11a,12a-octadecahydroindeno[1,2-b]fluorene-6,12-dione |
|---|---|
| PubChem CID | 76569383 |
| Molecular Formula | C40H44O2S4 |
| Molecular Weight | 685.06 g/mol |
| Exact Mass | 684.22 |
| IUPAC Name | 2,8-bis[3-methyl-5-(3-methylthiophen-2-yl)thiophen-2-yl]-1,2,3,4,4a,4b,5,5a,6a,7,8,9,10,10a,10b,11,11a,12a-octadecahydroindeno[1,2-b]fluorene-6,12-dione |
| SMILES | Cc1ccsc1-c1cc(C)c(C2CCC3C(C2)C(=O)C2CC4C(CC23)C(=O)C2CC(c3sc(-c5sccc5C)cc3C)CCC24)s1 |
| InChI | InChI=1S/C40H44O2S4/c1-19-9-11-43-39(19)33-13-21(3)37(45-33)23-5-7-25-27-17-32-28(18-31(27)35(41)29(25)15-23)26-8-6-24(16-30(26)36(32)42)38-22(4)14-34(46-38)40-20(2)10-12-44-40/h9-14,23-32H,5-8,15-18H2,1-4H3 |
| InChIKey | CFNWIAVOOMJKJY-UHFFFAOYSA-N |
| XLogP | 11.62 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.06 |
| LogP ≤ 5 | 11.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |