C21H24F3N7O — CID 76572959
4-[[9-pyrrolidin-3-yl-8-(2,4,6-trifluoroanilino)purin-2-yl]amino]cyclohexan-1-ol (PubChem CID 76572959) has the molecular formula C21H24F3N7O and a molecular weight of 447.47 g/mol. Its IUPAC name is 4-[[9-pyrrolidin-3-yl-8-(2,4,6-trifluoroanilino)purin-2-yl]amino]cyclohexan-1-ol.
| Compound Name | 4-[[9-pyrrolidin-3-yl-8-(2,4,6-trifluoroanilino)purin-2-yl]amino]cyclohexan-1-ol |
|---|---|
| PubChem CID | 76572959 |
| Molecular Formula | C21H24F3N7O |
| Molecular Weight | 447.47 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | 4-[[9-pyrrolidin-3-yl-8-(2,4,6-trifluoroanilino)purin-2-yl]amino]cyclohexan-1-ol |
| SMILES | OC1CCC(Nc2ncc3nc(Nc4c(F)cc(F)cc4F)n(C4CCNC4)c3n2)CC1 |
| InChI | InChI=1S/C21H24F3N7O/c22-11-7-15(23)18(16(24)8-11)29-21-28-17-10-26-20(27-12-1-3-14(32)4-2-12)30-19(17)31(21)13-5-6-25-9-13/h7-8,10,12-14,25,32H,1-6,9H2,(H,28,29)(H,26,27,30) |
| InChIKey | XTVKYRLYVFPDSZ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 99.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.47 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |