C11H19NO5 — CID 76574874
4-[[1-hydroxy-2-(hydroxymethyl)butan-2-yl]amino]-2,3-dimethyl-4-oxobut-2-enoic acid (PubChem CID 76574874) has the molecular formula C11H19NO5 and a molecular weight of 245.27 g/mol. Its IUPAC name is 4-[[1-hydroxy-2-(hydroxymethyl)butan-2-yl]amino]-2,3-dimethyl-4-oxobut-2-enoic acid.
| Compound Name | 4-[[1-hydroxy-2-(hydroxymethyl)butan-2-yl]amino]-2,3-dimethyl-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 76574874 |
| Molecular Formula | C11H19NO5 |
| Molecular Weight | 245.27 g/mol |
| Exact Mass | 245.13 |
| IUPAC Name | 4-[[1-hydroxy-2-(hydroxymethyl)butan-2-yl]amino]-2,3-dimethyl-4-oxobut-2-enoic acid |
| SMILES | CCC(CO)(CO)NC(=O)C(C)=C(C)C(=O)O |
| InChI | InChI=1S/C11H19NO5/c1-4-11(5-13,6-14)12-9(15)7(2)8(3)10(16)17/h13-14H,4-6H2,1-3H3,(H,12,15)(H,16,17) |
| InChIKey | IROATCRIKKSURR-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.27 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|