C35H34FN5O3 — CID 76579073
3-[2-[1-[[3-cyclopentyl-2-(5-fluoro-2-pyridinyl)-1-methylindole-6-carbonyl]amino]cyclobutyl]-3-methylbenzimidazol-5-yl]prop-2-enoic acid (PubChem CID 76579073) has the molecular formula C35H34FN5O3 and a molecular weight of 591.69 g/mol. Its IUPAC name is 3-[2-[1-[[3-cyclopentyl-2-(5-fluoro-2-pyridinyl)-1-methylindole-6-carbonyl]amino]cyclobutyl]-3-methylbenzimidazol-5-yl]prop-2-enoic acid.
| Compound Name | 3-[2-[1-[[3-cyclopentyl-2-(5-fluoro-2-pyridinyl)-1-methylindole-6-carbonyl]amino]cyclobutyl]-3-methylbenzimidazol-5-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 76579073 |
| Molecular Formula | C35H34FN5O3 |
| Molecular Weight | 591.69 g/mol |
| Exact Mass | 591.26 |
| IUPAC Name | 3-[2-[1-[[3-cyclopentyl-2-(5-fluoro-2-pyridinyl)-1-methylindole-6-carbonyl]amino]cyclobutyl]-3-methylbenzimidazol-5-yl]prop-2-enoic acid |
| SMILES | Cn1c(C2(NC(=O)c3ccc4c(C5CCCC5)c(-c5ccc(F)cn5)n(C)c4c3)CCC2)nc2ccc(C=CC(=O)O)cc21 |
| InChI | InChI=1S/C35H34FN5O3/c1-40-28-19-23(10-12-25(28)31(22-6-3-4-7-22)32(40)27-14-11-24(36)20-37-27)33(44)39-35(16-5-17-35)34-38-26-13-8-21(9-15-30(42)43)18-29(26)41(34)2/h8-15,18-20,22H,3-7,16-17H2,1-2H3,(H,39,44)(H,42,43) |
| InChIKey | DOHAGISBHBIBLP-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 102.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.69 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|