C15H19N3O4S — CID 7658172
N-cyclopropyl-N'-(1-methylsulfonyl-3,4-dihydro-2H-quinolin-6-yl)oxamide (PubChem CID 7658172) has the molecular formula C15H19N3O4S and a molecular weight of 337.40 g/mol. Its IUPAC name is N-cyclopropyl-N'-(1-methylsulfonyl-3,4-dihydro-2H-quinolin-6-yl)oxamide.
| Compound Name | N-cyclopropyl-N'-(1-methylsulfonyl-3,4-dihydro-2H-quinolin-6-yl)oxamide |
|---|---|
| PubChem CID | 7658172 |
| Molecular Formula | C15H19N3O4S |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | N-cyclopropyl-N'-(1-methylsulfonyl-3,4-dihydro-2H-quinolin-6-yl)oxamide |
| SMILES | CS(=O)(=O)N1CCCc2cc(NC(=O)C(=O)NC3CC3)ccc21 |
| InChI | InChI=1S/C15H19N3O4S/c1-23(21,22)18-8-2-3-10-9-12(6-7-13(10)18)17-15(20)14(19)16-11-4-5-11/h6-7,9,11H,2-5,8H2,1H3,(H,16,19)(H,17,20) |
| InChIKey | GPRFVBDTZBKRLZ-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|