About [4-(1-chloropyrido[3,4-d]pyridazin-4-yl)-2-methylpiperazin-1-yl]-piperidin-1-ylmethanone
[4-(1-chloropyrido[3,4-d]pyridazin-4-yl)-2-methylpiperazin-1-yl]-piperidin-1-ylmethanone (PubChem CID 76585156) has the molecular formula C18H23ClN6O
and a molecular weight of 374.88 g/mol. Its IUPAC name is [4-(1-chloropyrido[3,4-d]pyridazin-4-yl)-2-methylpiperazin-1-yl]-piperidin-1-ylmethanone.
Molecular Properties
| Compound Name | [4-(1-chloropyrido[3,4-d]pyridazin-4-yl)-2-methylpiperazin-1-yl]-piperidin-1-ylmethanone |
| PubChem CID | 76585156 |
| Molecular Formula | C18H23ClN6O |
| Molecular Weight | 374.88 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | [4-(1-chloropyrido[3,4-d]pyridazin-4-yl)-2-methylpiperazin-1-yl]-piperidin-1-ylmethanone |
| SMILES | CC1CN(c2nnc(Cl)c3ccncc23)CCN1C(=O)N1CCCCC1 |
| InChI | InChI=1S/C18H23ClN6O/c1-13-12-24(9-10-25(13)18(26)23-7-3-2-4-8-23)17-15-11-20-6-5-14(15)16(19)21-22-17/h5-6,11,13H,2-4,7-10,12H2,1H3 |
| InChIKey | PLDWAHLGSFWTTH-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 65.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.88 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [4-(1-chloropyrido[3,4-d]pyridazin-4-yl)-2-methylpiperazin-1-yl]-piperidin-1-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(1-chloropyrido[3,4-d]pyridazin-4-yl)-2-methylpiperazin-1-yl]-piperidin-1-ylmethanone?
The IUPAC name of [4-(1-chloropyrido[3,4-d]pyridazin-4-yl)-2-methylpiperazin-1-yl]-piperidin-1-ylmethanone (CID 76585156) is [4-(1-chloropyrido[3,4-d]pyridazin-4-yl)-2-methylpiperazin-1-yl]-piperidin-1-ylmethanone.
What is the SMILES notation for [4-(1-chloropyrido[3,4-d]pyridazin-4-yl)-2-methylpiperazin-1-yl]-piperidin-1-ylmethanone?
The canonical SMILES for [4-(1-chloropyrido[3,4-d]pyridazin-4-yl)-2-methylpiperazin-1-yl]-piperidin-1-ylmethanone is CC1CN(c2nnc(Cl)c3ccncc23)CCN1C(=O)N1CCCCC1.
What is the InChIKey of [4-(1-chloropyrido[3,4-d]pyridazin-4-yl)-2-methylpiperazin-1-yl]-piperidin-1-ylmethanone?
The InChIKey is PLDWAHLGSFWTTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23ClN6O/c1-13-12-24(9-10-25(13)18(26)23-7-3-2-4-8-23)17-15-11-20-6-5-14(15)16(19)21-22-17/h5-6,11,13H,2-4,7-10,12H2,1H3.
What are the key properties of [4-(1-chloropyrido[3,4-d]pyridazin-4-yl)-2-methylpiperazin-1-yl]-piperidin-1-ylmethanone?
[4-(1-chloropyrido[3,4-d]pyridazin-4-yl)-2-methylpiperazin-1-yl]-piperidin-1-ylmethanone has a molecular weight of 374.88 g/mol, XLogP of 2.79, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(1-chloropyrido[3,4-d]pyridazin-4-yl)-2-methylpiperazin-1-yl]-piperidin-1-ylmethanone is sourced from PubChem (CID 76585156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).