About [4-(8-chloropyrido[2,3-d]pyridazin-5-yl)-3-methylpiperazin-1-yl]-phenylmethanone
[4-(8-chloropyrido[2,3-d]pyridazin-5-yl)-3-methylpiperazin-1-yl]-phenylmethanone (PubChem CID 76585158) has the molecular formula C19H18ClN5O
and a molecular weight of 367.84 g/mol. Its IUPAC name is [4-(8-chloropyrido[2,3-d]pyridazin-5-yl)-3-methylpiperazin-1-yl]-phenylmethanone.
Molecular Properties
| Compound Name | [4-(8-chloropyrido[2,3-d]pyridazin-5-yl)-3-methylpiperazin-1-yl]-phenylmethanone |
| PubChem CID | 76585158 |
| Molecular Formula | C19H18ClN5O |
| Molecular Weight | 367.84 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | [4-(8-chloropyrido[2,3-d]pyridazin-5-yl)-3-methylpiperazin-1-yl]-phenylmethanone |
| SMILES | CC1CN(C(=O)c2ccccc2)CCN1c1nnc(Cl)c2ncccc12 |
| InChI | InChI=1S/C19H18ClN5O/c1-13-12-24(19(26)14-6-3-2-4-7-14)10-11-25(13)18-15-8-5-9-21-16(15)17(20)22-23-18/h2-9,13H,10-12H2,1H3 |
| InChIKey | AZNOTTMEXODPHY-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 62.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.84 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [4-(8-chloropyrido[2,3-d]pyridazin-5-yl)-3-methylpiperazin-1-yl]-phenylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(8-chloropyrido[2,3-d]pyridazin-5-yl)-3-methylpiperazin-1-yl]-phenylmethanone?
The IUPAC name of [4-(8-chloropyrido[2,3-d]pyridazin-5-yl)-3-methylpiperazin-1-yl]-phenylmethanone (CID 76585158) is [4-(8-chloropyrido[2,3-d]pyridazin-5-yl)-3-methylpiperazin-1-yl]-phenylmethanone.
What is the SMILES notation for [4-(8-chloropyrido[2,3-d]pyridazin-5-yl)-3-methylpiperazin-1-yl]-phenylmethanone?
The canonical SMILES for [4-(8-chloropyrido[2,3-d]pyridazin-5-yl)-3-methylpiperazin-1-yl]-phenylmethanone is CC1CN(C(=O)c2ccccc2)CCN1c1nnc(Cl)c2ncccc12.
What is the InChIKey of [4-(8-chloropyrido[2,3-d]pyridazin-5-yl)-3-methylpiperazin-1-yl]-phenylmethanone?
The InChIKey is AZNOTTMEXODPHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18ClN5O/c1-13-12-24(19(26)14-6-3-2-4-7-14)10-11-25(13)18-15-8-5-9-21-16(15)17(20)22-23-18/h2-9,13H,10-12H2,1H3.
What are the key properties of [4-(8-chloropyrido[2,3-d]pyridazin-5-yl)-3-methylpiperazin-1-yl]-phenylmethanone?
[4-(8-chloropyrido[2,3-d]pyridazin-5-yl)-3-methylpiperazin-1-yl]-phenylmethanone has a molecular weight of 367.84 g/mol, XLogP of 3.03, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(8-chloropyrido[2,3-d]pyridazin-5-yl)-3-methylpiperazin-1-yl]-phenylmethanone is sourced from PubChem (CID 76585158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).