About 2-(2-phenylethyl)-1,3-benzoxazol-5-amine
2-(2-phenylethyl)-1,3-benzoxazol-5-amine (PubChem CID 765854) has the molecular formula C15H14N2O
and a molecular weight of 238.29 g/mol. Its IUPAC name is 2-(2-phenylethyl)-1,3-benzoxazol-5-amine.
Molecular Properties
| Compound Name | 2-(2-phenylethyl)-1,3-benzoxazol-5-amine |
| PubChem CID | 765854 |
| Molecular Formula | C15H14N2O |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | 2-(2-phenylethyl)-1,3-benzoxazol-5-amine |
| SMILES | Nc1ccc2oc(CCc3ccccc3)nc2c1 |
| InChI | InChI=1S/C15H14N2O/c16-12-7-8-14-13(10-12)17-15(18-14)9-6-11-4-2-1-3-5-11/h1-5,7-8,10H,6,9,16H2 |
| InChIKey | JYDYEDVFQNITAL-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-phenylethyl)-1,3-benzoxazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-phenylethyl)-1,3-benzoxazol-5-amine?
The IUPAC name of 2-(2-phenylethyl)-1,3-benzoxazol-5-amine (CID 765854) is 2-(2-phenylethyl)-1,3-benzoxazol-5-amine.
What is the SMILES notation for 2-(2-phenylethyl)-1,3-benzoxazol-5-amine?
The canonical SMILES for 2-(2-phenylethyl)-1,3-benzoxazol-5-amine is Nc1ccc2oc(CCc3ccccc3)nc2c1.
What is the InChIKey of 2-(2-phenylethyl)-1,3-benzoxazol-5-amine?
The InChIKey is JYDYEDVFQNITAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14N2O/c16-12-7-8-14-13(10-12)17-15(18-14)9-6-11-4-2-1-3-5-11/h1-5,7-8,10H,6,9,16H2.
What are the key properties of 2-(2-phenylethyl)-1,3-benzoxazol-5-amine?
2-(2-phenylethyl)-1,3-benzoxazol-5-amine has a molecular weight of 238.29 g/mol, XLogP of 3.20, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-phenylethyl)-1,3-benzoxazol-5-amine is sourced from PubChem (CID 765854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).