C18H17ClF3N3O4S — CID 76585505
N-[5-[(5-chloro-2-pyridinyl)sulfamoyl]-8-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl]-2,2,2-trifluoroacetamide (PubChem CID 76585505) has the molecular formula C18H17ClF3N3O4S and a molecular weight of 463.87 g/mol. Its IUPAC name is N-[5-[(5-chloro-2-pyridinyl)sulfamoyl]-8-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[5-[(5-chloro-2-pyridinyl)sulfamoyl]-8-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 76585505 |
| Molecular Formula | C18H17ClF3N3O4S |
| Molecular Weight | 463.87 g/mol |
| Exact Mass | 463.06 |
| IUPAC Name | N-[5-[(5-chloro-2-pyridinyl)sulfamoyl]-8-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl]-2,2,2-trifluoroacetamide |
| SMILES | COc1ccc(S(=O)(=O)Nc2ccc(Cl)cn2)c2c1CC(NC(=O)C(F)(F)F)CC2 |
| InChI | InChI=1S/C18H17ClF3N3O4S/c1-29-14-5-6-15(30(27,28)25-16-7-2-10(19)9-23-16)12-4-3-11(8-13(12)14)24-17(26)18(20,21)22/h2,5-7,9,11H,3-4,8H2,1H3,(H,23,25)(H,24,26) |
| InChIKey | TVEXXWXEHKPXQA-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.87 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |