C19H23NO3 — CID 765866
9-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-6-methyl-3,4-dihydro-2H-carbazol-1-one (PubChem CID 765866) has the molecular formula C19H23NO3 and a molecular weight of 313.40 g/mol. Its IUPAC name is 9-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-6-methyl-3,4-dihydro-2H-carbazol-1-one.
| Compound Name | 9-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-6-methyl-3,4-dihydro-2H-carbazol-1-one |
|---|---|
| PubChem CID | 765866 |
| Molecular Formula | C19H23NO3 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | 9-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-6-methyl-3,4-dihydro-2H-carbazol-1-one |
| SMILES | Cc1ccc2c(c1)c1c(n2C[C@@H]2COC(C)(C)O2)C(=O)CCC1 |
| InChI | InChI=1S/C19H23NO3/c1-12-7-8-16-15(9-12)14-5-4-6-17(21)18(14)20(16)10-13-11-22-19(2,3)23-13/h7-9,13H,4-6,10-11H2,1-3H3/t13-/m1/s1 |
| InChIKey | NKNDIVVMNHNKRM-CYBMUJFWSA-N |
| XLogP | 3.62 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|