C13H22O3 — CID 76587631
1,4,4,7,9-pentamethyl-3,5,11-trioxatricyclo[5.3.1.02,6]undecane (PubChem CID 76587631) has the molecular formula C13H22O3 and a molecular weight of 226.32 g/mol. Its IUPAC name is 1,4,4,7,9-pentamethyl-3,5,11-trioxatricyclo[5.3.1.02,6]undecane.
| Compound Name | 1,4,4,7,9-pentamethyl-3,5,11-trioxatricyclo[5.3.1.02,6]undecane |
|---|---|
| PubChem CID | 76587631 |
| Molecular Formula | C13H22O3 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.16 |
| IUPAC Name | 1,4,4,7,9-pentamethyl-3,5,11-trioxatricyclo[5.3.1.02,6]undecane |
| SMILES | CC1CC2(C)OC(C)(C1)C1OC(C)(C)OC12 |
| InChI | InChI=1S/C13H22O3/c1-8-6-12(4)9-10(13(5,7-8)16-12)15-11(2,3)14-9/h8-10H,6-7H2,1-5H3 |
| InChIKey | CABYRKRFWRBCMW-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |