C20H25N3O3 — CID 7658883
ethyl (2R)-2-[6-oxo-3-(4-piperidin-1-ylphenyl)pyridazin-1-yl]propanoate (PubChem CID 7658883) has the molecular formula C20H25N3O3 and a molecular weight of 355.44 g/mol. Its IUPAC name is ethyl (2R)-2-[6-oxo-3-(4-piperidin-1-ylphenyl)pyridazin-1-yl]propanoate.
| Compound Name | ethyl (2R)-2-[6-oxo-3-(4-piperidin-1-ylphenyl)pyridazin-1-yl]propanoate |
|---|---|
| PubChem CID | 7658883 |
| Molecular Formula | C20H25N3O3 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | ethyl (2R)-2-[6-oxo-3-(4-piperidin-1-ylphenyl)pyridazin-1-yl]propanoate |
| SMILES | CCOC(=O)[C@@H](C)n1nc(-c2ccc(N3CCCCC3)cc2)ccc1=O |
| InChI | InChI=1S/C20H25N3O3/c1-3-26-20(25)15(2)23-19(24)12-11-18(21-23)16-7-9-17(10-8-16)22-13-5-4-6-14-22/h7-12,15H,3-6,13-14H2,1-2H3/t15-/m1/s1 |
| InChIKey | HPIMPYFDNBLUBS-OAHLLOKOSA-N |
| XLogP | 3.02 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |