C20H20Cl2F3N3O4S — CID 76588853
[3,5-dichloro-4-[[1-(1-methyl-4,5,6,7-tetrahydroindazol-5-yl)-2-oxopyrrolidin-3-yl]methyl]phenyl] trifluoromethanesulfonate (PubChem CID 76588853) has the molecular formula C20H20Cl2F3N3O4S and a molecular weight of 526.36 g/mol. Its IUPAC name is [3,5-dichloro-4-[[1-(1-methyl-4,5,6,7-tetrahydroindazol-5-yl)-2-oxopyrrolidin-3-yl]methyl]phenyl] trifluoromethanesulfonate.
| Compound Name | [3,5-dichloro-4-[[1-(1-methyl-4,5,6,7-tetrahydroindazol-5-yl)-2-oxopyrrolidin-3-yl]methyl]phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 76588853 |
| Molecular Formula | C20H20Cl2F3N3O4S |
| Molecular Weight | 526.36 g/mol |
| Exact Mass | 525.05 |
| IUPAC Name | [3,5-dichloro-4-[[1-(1-methyl-4,5,6,7-tetrahydroindazol-5-yl)-2-oxopyrrolidin-3-yl]methyl]phenyl] trifluoromethanesulfonate |
| SMILES | Cn1ncc2c1CCC(N1CCC(Cc3c(Cl)cc(OS(=O)(=O)C(F)(F)F)cc3Cl)C1=O)C2 |
| InChI | InChI=1S/C20H20Cl2F3N3O4S/c1-27-18-3-2-13(6-12(18)10-26-27)28-5-4-11(19(28)29)7-15-16(21)8-14(9-17(15)22)32-33(30,31)20(23,24)25/h8-11,13H,2-7H2,1H3 |
| InChIKey | GSVSKRHRDBPFER-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.36 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|