About 2,5-dimethylidenepyrazine
2,5-dimethylidenepyrazine (PubChem CID 76588964) has the molecular formula C6H6N2
and a molecular weight of 106.13 g/mol. Its IUPAC name is 2,5-dimethylidenepyrazine.
Molecular Properties
| Compound Name | 2,5-dimethylidenepyrazine |
| PubChem CID | 76588964 |
| Molecular Formula | C6H6N2 |
| Molecular Weight | 106.13 g/mol |
| Exact Mass | 106.05 |
| IUPAC Name | 2,5-dimethylidenepyrazine |
| SMILES | C=c1cnc(=C)cn1 |
| InChI | InChI=1S/C6H6N2/c1-5-3-8-6(2)4-7-5/h3-4H,1-2H2 |
| InChIKey | WXYQCLFCFCGRQY-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 106.13 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,5-dimethylidenepyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dimethylidenepyrazine?
The IUPAC name of 2,5-dimethylidenepyrazine (CID 76588964) is 2,5-dimethylidenepyrazine.
What is the SMILES notation for 2,5-dimethylidenepyrazine?
The canonical SMILES for 2,5-dimethylidenepyrazine is C=c1cnc(=C)cn1.
What is the InChIKey of 2,5-dimethylidenepyrazine?
The InChIKey is WXYQCLFCFCGRQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N2/c1-5-3-8-6(2)4-7-5/h3-4H,1-2H2.
What are the key properties of 2,5-dimethylidenepyrazine?
2,5-dimethylidenepyrazine has a molecular weight of 106.13 g/mol, XLogP of -0.70, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dimethylidenepyrazine is sourced from PubChem (CID 76588964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).