C7H12N4 — CID 76594383
4-azido-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole (PubChem CID 76594383) has the molecular formula C7H12N4 and a molecular weight of 152.20 g/mol. Its IUPAC name is 4-azido-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole.
| Compound Name | 4-azido-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole |
|---|---|
| PubChem CID | 76594383 |
| Molecular Formula | C7H12N4 |
| Molecular Weight | 152.20 g/mol |
| Exact Mass | 152.11 |
| IUPAC Name | 4-azido-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole |
| SMILES | [N-]=[N+]=NC1CCC2CNCC21 |
| InChI | InChI=1S/C7H12N4/c8-11-10-7-2-1-5-3-9-4-6(5)7/h5-7,9H,1-4H2 |
| InChIKey | CKLZGXPOWHFKIZ-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 60.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.20 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|