C15H10Cl2N2O2 — CID 7659505
2-[(2,4-dichlorophenyl)methyl]-6-(furan-2-yl)pyridazin-3-one (PubChem CID 7659505) has the molecular formula C15H10Cl2N2O2 and a molecular weight of 321.16 g/mol. Its IUPAC name is 2-[(2,4-dichlorophenyl)methyl]-6-(furan-2-yl)pyridazin-3-one.
| Compound Name | 2-[(2,4-dichlorophenyl)methyl]-6-(furan-2-yl)pyridazin-3-one |
|---|---|
| PubChem CID | 7659505 |
| Molecular Formula | C15H10Cl2N2O2 |
| Molecular Weight | 321.16 g/mol |
| Exact Mass | 320.01 |
| IUPAC Name | 2-[(2,4-dichlorophenyl)methyl]-6-(furan-2-yl)pyridazin-3-one |
| SMILES | O=c1ccc(-c2ccco2)nn1Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H10Cl2N2O2/c16-11-4-3-10(12(17)8-11)9-19-15(20)6-5-13(18-19)14-2-1-7-21-14/h1-8H,9H2 |
| InChIKey | ZMULODHEUGSRPA-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 48.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.16 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |