C6H4F6N2O2 — CID 76595213
5,6-bis(trifluoromethyl)-1,3-diazinane-2,4-dione (PubChem CID 76595213) has the molecular formula C6H4F6N2O2 and a molecular weight of 250.10 g/mol. Its IUPAC name is 5,6-bis(trifluoromethyl)-1,3-diazinane-2,4-dione.
| Compound Name | 5,6-bis(trifluoromethyl)-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 76595213 |
| Molecular Formula | C6H4F6N2O2 |
| Molecular Weight | 250.10 g/mol |
| Exact Mass | 250.02 |
| IUPAC Name | 5,6-bis(trifluoromethyl)-1,3-diazinane-2,4-dione |
| SMILES | O=C1NC(=O)C(C(F)(F)F)C(C(F)(F)F)N1 |
| InChI | InChI=1S/C6H4F6N2O2/c7-5(8,9)1-2(6(10,11)12)13-4(16)14-3(1)15/h1-2H,(H2,13,14,15,16) |
| InChIKey | WWQBVGMAMZKNSM-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.10 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |