About 2,4-dimethylchromen-7-one
2,4-dimethylchromen-7-one (PubChem CID 765984) has the molecular formula C11H10O2
and a molecular weight of 174.20 g/mol. Its IUPAC name is 2,4-dimethylchromen-7-one.
Molecular Properties
| Compound Name | 2,4-dimethylchromen-7-one |
| PubChem CID | 765984 |
| Molecular Formula | C11H10O2 |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.07 |
| IUPAC Name | 2,4-dimethylchromen-7-one |
| SMILES | Cc1cc(C)c2ccc(=O)cc-2o1 |
| InChI | InChI=1S/C11H10O2/c1-7-5-8(2)13-11-6-9(12)3-4-10(7)11/h3-6H,1-2H3 |
| InChIKey | GCRCLVFZNTXKDW-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,4-dimethylchromen-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dimethylchromen-7-one?
The IUPAC name of 2,4-dimethylchromen-7-one (CID 765984) is 2,4-dimethylchromen-7-one.
What is the SMILES notation for 2,4-dimethylchromen-7-one?
The canonical SMILES for 2,4-dimethylchromen-7-one is Cc1cc(C)c2ccc(=O)cc-2o1.
What is the InChIKey of 2,4-dimethylchromen-7-one?
The InChIKey is GCRCLVFZNTXKDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10O2/c1-7-5-8(2)13-11-6-9(12)3-4-10(7)11/h3-6H,1-2H3.
What are the key properties of 2,4-dimethylchromen-7-one?
2,4-dimethylchromen-7-one has a molecular weight of 174.20 g/mol, XLogP of 2.36, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethylchromen-7-one is sourced from PubChem (CID 765984), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).