C36H51BF6O3Si — CID 76599679
tert-butyl-dimethyl-[1,1,1-trifluoro-4-[2-methyl-4-[3-[3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pentan-3-yl]phenyl]-2-(trifluoromethyl)but-3-en-2-yl]oxysilane (PubChem CID 76599679) has the molecular formula C36H51BF6O3Si and a molecular weight of 684.69 g/mol. Its IUPAC name is tert-butyl-dimethyl-[1,1,1-trifluoro-4-[2-methyl-4-[3-[3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pentan-3-yl]phenyl]-2-(trifluoromethyl)but-3-en-2-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[1,1,1-trifluoro-4-[2-methyl-4-[3-[3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pentan-3-yl]phenyl]-2-(trifluoromethyl)but-3-en-2-yl]oxysilane |
|---|---|
| PubChem CID | 76599679 |
| Molecular Formula | C36H51BF6O3Si |
| Molecular Weight | 684.69 g/mol |
| Exact Mass | 684.36 |
| IUPAC Name | tert-butyl-dimethyl-[1,1,1-trifluoro-4-[2-methyl-4-[3-[3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pentan-3-yl]phenyl]-2-(trifluoromethyl)but-3-en-2-yl]oxysilane |
| SMILES | CCC(CC)(c1ccc(C=CC(O[Si](C)(C)C(C)(C)C)(C(F)(F)F)C(F)(F)F)c(C)c1)c1ccc(B2OC(C)(C)C(C)(C)O2)c(C)c1 |
| InChI | InChI=1S/C36H51BF6O3Si/c1-14-33(15-2,28-18-19-29(25(4)23-28)37-44-31(8,9)32(10,11)45-37)27-17-16-26(24(3)22-27)20-21-34(35(38,39)40,36(41,42)43)46-47(12,13)30(5,6)7/h16-23H,14-15H2,1-13H3 |
| InChIKey | DUJSHJHCUOIWOT-UHFFFAOYSA-N |
| XLogP | 10.61 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.69 |
| LogP ≤ 5 | 10.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|