About N-ethenyl-N-(2-methylnona-2,6-dienyl)acetamide
N-ethenyl-N-(2-methylnona-2,6-dienyl)acetamide (PubChem CID 76600115) has the molecular formula C14H23NO
and a molecular weight of 221.34 g/mol. Its IUPAC name is N-ethenyl-N-(2-methylnona-2,6-dienyl)acetamide.
Molecular Properties
| Compound Name | N-ethenyl-N-(2-methylnona-2,6-dienyl)acetamide |
| PubChem CID | 76600115 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | N-ethenyl-N-(2-methylnona-2,6-dienyl)acetamide |
| SMILES | C=CN(CC(C)=CCCC=CCC)C(C)=O |
| InChI | InChI=1S/C14H23NO/c1-5-7-8-9-10-11-13(3)12-15(6-2)14(4)16/h6-8,11H,2,5,9-10,12H2,1,3-4H3 |
| InChIKey | XOFXCKZCDIZAQX-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-ethenyl-N-(2-methylnona-2,6-dienyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethenyl-N-(2-methylnona-2,6-dienyl)acetamide?
The IUPAC name of N-ethenyl-N-(2-methylnona-2,6-dienyl)acetamide (CID 76600115) is N-ethenyl-N-(2-methylnona-2,6-dienyl)acetamide.
What is the SMILES notation for N-ethenyl-N-(2-methylnona-2,6-dienyl)acetamide?
The canonical SMILES for N-ethenyl-N-(2-methylnona-2,6-dienyl)acetamide is C=CN(CC(C)=CCCC=CCC)C(C)=O.
What is the InChIKey of N-ethenyl-N-(2-methylnona-2,6-dienyl)acetamide?
The InChIKey is XOFXCKZCDIZAQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23NO/c1-5-7-8-9-10-11-13(3)12-15(6-2)14(4)16/h6-8,11H,2,5,9-10,12H2,1,3-4H3.
What are the key properties of N-ethenyl-N-(2-methylnona-2,6-dienyl)acetamide?
N-ethenyl-N-(2-methylnona-2,6-dienyl)acetamide has a molecular weight of 221.34 g/mol, XLogP of 3.67, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethenyl-N-(2-methylnona-2,6-dienyl)acetamide is sourced from PubChem (CID 76600115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).