C22H27N5O3 — CID 76601235
3-[5-(2-ethoxyethyl)-1,2,4-triazol-1-yl]-N-(1-hydroxypropan-2-yl)-5-(5-methyl-2-pyridinyl)benzamide (PubChem CID 76601235) has the molecular formula C22H27N5O3 and a molecular weight of 409.49 g/mol. Its IUPAC name is 3-[5-(2-ethoxyethyl)-1,2,4-triazol-1-yl]-N-(1-hydroxypropan-2-yl)-5-(5-methyl-2-pyridinyl)benzamide.
| Compound Name | 3-[5-(2-ethoxyethyl)-1,2,4-triazol-1-yl]-N-(1-hydroxypropan-2-yl)-5-(5-methyl-2-pyridinyl)benzamide |
|---|---|
| PubChem CID | 76601235 |
| Molecular Formula | C22H27N5O3 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.21 |
| IUPAC Name | 3-[5-(2-ethoxyethyl)-1,2,4-triazol-1-yl]-N-(1-hydroxypropan-2-yl)-5-(5-methyl-2-pyridinyl)benzamide |
| SMILES | CCOCCc1ncnn1-c1cc(C(=O)NC(C)CO)cc(-c2ccc(C)cn2)c1 |
| InChI | InChI=1S/C22H27N5O3/c1-4-30-8-7-21-24-14-25-27(21)19-10-17(20-6-5-15(2)12-23-20)9-18(11-19)22(29)26-16(3)13-28/h5-6,9-12,14,16,28H,4,7-8,13H2,1-3H3,(H,26,29) |
| InChIKey | RFSRNRHLEYMANN-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|