About 6-(3-acetylphenyl)benzo[d][2]benzazepine-5,7-dione
6-(3-acetylphenyl)benzo[d][2]benzazepine-5,7-dione (PubChem CID 766014) has the molecular formula C22H15NO3
and a molecular weight of 341.37 g/mol. Its IUPAC name is 6-(3-acetylphenyl)benzo[d][2]benzazepine-5,7-dione.
Molecular Properties
| Compound Name | 6-(3-acetylphenyl)benzo[d][2]benzazepine-5,7-dione |
| PubChem CID | 766014 |
| Molecular Formula | C22H15NO3 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | 6-(3-acetylphenyl)benzo[d][2]benzazepine-5,7-dione |
| SMILES | CC(=O)c1cccc(-n2c(=O)c3ccccc3c3ccccc3c2=O)c1 |
| InChI | InChI=1S/C22H15NO3/c1-14(24)15-7-6-8-16(13-15)23-21(25)19-11-4-2-9-17(19)18-10-3-5-12-20(18)22(23)26/h2-13H,1H3 |
| InChIKey | FEFMLQRFASSLKA-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 56.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-(3-acetylphenyl)benzo[d][2]benzazepine-5,7-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(3-acetylphenyl)benzo[d][2]benzazepine-5,7-dione?
The IUPAC name of 6-(3-acetylphenyl)benzo[d][2]benzazepine-5,7-dione (CID 766014) is 6-(3-acetylphenyl)benzo[d][2]benzazepine-5,7-dione.
What is the SMILES notation for 6-(3-acetylphenyl)benzo[d][2]benzazepine-5,7-dione?
The canonical SMILES for 6-(3-acetylphenyl)benzo[d][2]benzazepine-5,7-dione is CC(=O)c1cccc(-n2c(=O)c3ccccc3c3ccccc3c2=O)c1.
What is the InChIKey of 6-(3-acetylphenyl)benzo[d][2]benzazepine-5,7-dione?
The InChIKey is FEFMLQRFASSLKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H15NO3/c1-14(24)15-7-6-8-16(13-15)23-21(25)19-11-4-2-9-17(19)18-10-3-5-12-20(18)22(23)26/h2-13H,1H3.
What are the key properties of 6-(3-acetylphenyl)benzo[d][2]benzazepine-5,7-dione?
6-(3-acetylphenyl)benzo[d][2]benzazepine-5,7-dione has a molecular weight of 341.37 g/mol, XLogP of 3.71, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3-acetylphenyl)benzo[d][2]benzazepine-5,7-dione is sourced from PubChem (CID 766014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).