About (E)-N'-(2-chlorophenyl)but-2-enediamide
(E)-N'-(2-chlorophenyl)but-2-enediamide (PubChem CID 766033) has the molecular formula C10H9ClN2O2
and a molecular weight of 224.65 g/mol. Its IUPAC name is (E)-N'-(2-chlorophenyl)but-2-enediamide.
Molecular Properties
| Compound Name | (E)-N'-(2-chlorophenyl)but-2-enediamide |
| PubChem CID | 766033 |
| Molecular Formula | C10H9ClN2O2 |
| Molecular Weight | 224.65 g/mol |
| Exact Mass | 224.04 |
| IUPAC Name | (E)-N'-(2-chlorophenyl)but-2-enediamide |
| SMILES | NC(=O)/C=C/C(=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C10H9ClN2O2/c11-7-3-1-2-4-8(7)13-10(15)6-5-9(12)14/h1-6H,(H2,12,14)(H,13,15)/b6-5+ |
| InChIKey | JSJRBJRXVXUQLB-AATRIKPKSA-N |
| XLogP | 1.32 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.65 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-N'-(2-chlorophenyl)but-2-enediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N'-(2-chlorophenyl)but-2-enediamide?
The IUPAC name of (E)-N'-(2-chlorophenyl)but-2-enediamide (CID 766033) is (E)-N'-(2-chlorophenyl)but-2-enediamide.
What is the SMILES notation for (E)-N'-(2-chlorophenyl)but-2-enediamide?
The canonical SMILES for (E)-N'-(2-chlorophenyl)but-2-enediamide is NC(=O)/C=C/C(=O)Nc1ccccc1Cl.
What is the InChIKey of (E)-N'-(2-chlorophenyl)but-2-enediamide?
The InChIKey is JSJRBJRXVXUQLB-AATRIKPKSA-N. The full InChI is InChI=1S/C10H9ClN2O2/c11-7-3-1-2-4-8(7)13-10(15)6-5-9(12)14/h1-6H,(H2,12,14)(H,13,15)/b6-5+.
What are the key properties of (E)-N'-(2-chlorophenyl)but-2-enediamide?
(E)-N'-(2-chlorophenyl)but-2-enediamide has a molecular weight of 224.65 g/mol, XLogP of 1.32, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N'-(2-chlorophenyl)but-2-enediamide is sourced from PubChem (CID 766033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).