C7H11N3O — CID 76603913
2,5-diimino-3-methylhex-3-enamide (PubChem CID 76603913) has the molecular formula C7H11N3O and a molecular weight of 153.19 g/mol. Its IUPAC name is 2,5-diimino-3-methylhex-3-enamide.
| Compound Name | 2,5-diimino-3-methylhex-3-enamide |
|---|---|
| PubChem CID | 76603913 |
| Molecular Formula | C7H11N3O |
| Molecular Weight | 153.19 g/mol |
| Exact Mass | 153.09 |
| IUPAC Name | 2,5-diimino-3-methylhex-3-enamide |
| SMILES | [H]/N=C(\C(N)=O)C(C)=C/C(C)=N/[H] |
| InChI | InChI=1S/C7H11N3O/c1-4(3-5(2)8)6(9)7(10)11/h3,8-9H,1-2H3,(H2,10,11)/b4-3?,8-5+,9-6- |
| InChIKey | DGZSSODGIJBSNJ-JILKDKKASA-N |
| XLogP | 0.48 |
| TPSA | 90.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.19 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|