C8H13N3 — CID 76605143
3,5-dimethyl-4-methylidene-2H-1,3,5-triazocine (PubChem CID 76605143) has the molecular formula C8H13N3 and a molecular weight of 151.21 g/mol. Its IUPAC name is 3,5-dimethyl-4-methylidene-2H-1,3,5-triazocine.
| Compound Name | 3,5-dimethyl-4-methylidene-2H-1,3,5-triazocine |
|---|---|
| PubChem CID | 76605143 |
| Molecular Formula | C8H13N3 |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.11 |
| IUPAC Name | 3,5-dimethyl-4-methylidene-2H-1,3,5-triazocine |
| SMILES | C=C1N(C)C=CC=NCN1C |
| InChI | InChI=1S/C8H13N3/c1-8-10(2)6-4-5-9-7-11(8)3/h4-6H,1,7H2,2-3H3 |
| InChIKey | OXWLITGIXIDDCU-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |