C21H21Cl3N4O — CID 76605150
1-[9-chloro-1-(2,4-dichlorophenyl)-3,4-dihydro-2H-pyrimido[1,2-a]benzimidazol-6-yl]-N-ethoxypropan-1-imine (PubChem CID 76605150) has the molecular formula C21H21Cl3N4O and a molecular weight of 451.79 g/mol. Its IUPAC name is 1-[9-chloro-1-(2,4-dichlorophenyl)-3,4-dihydro-2H-pyrimido[1,2-a]benzimidazol-6-yl]-N-ethoxypropan-1-imine.
| Compound Name | 1-[9-chloro-1-(2,4-dichlorophenyl)-3,4-dihydro-2H-pyrimido[1,2-a]benzimidazol-6-yl]-N-ethoxypropan-1-imine |
|---|---|
| PubChem CID | 76605150 |
| Molecular Formula | C21H21Cl3N4O |
| Molecular Weight | 451.79 g/mol |
| Exact Mass | 450.08 |
| IUPAC Name | 1-[9-chloro-1-(2,4-dichlorophenyl)-3,4-dihydro-2H-pyrimido[1,2-a]benzimidazol-6-yl]-N-ethoxypropan-1-imine |
| SMILES | CCON=C(CC)c1ccc(Cl)c2nc3n(c12)CCCN3c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C21H21Cl3N4O/c1-3-17(26-29-4-2)14-7-8-15(23)19-20(14)28-11-5-10-27(21(28)25-19)18-9-6-13(22)12-16(18)24/h6-9,12H,3-5,10-11H2,1-2H3 |
| InChIKey | ZERLXXXJSXSOLL-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 42.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.79 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|