C26H58O2Si2 — CID 76605457
tert-butyl-[10-[tert-butyl(dimethyl)silyl]oxy-2,6,8,8-tetramethyldecan-2-yl]oxy-dimethylsilane (PubChem CID 76605457) has the molecular formula C26H58O2Si2 and a molecular weight of 458.92 g/mol. Its IUPAC name is tert-butyl-[10-[tert-butyl(dimethyl)silyl]oxy-2,6,8,8-tetramethyldecan-2-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[10-[tert-butyl(dimethyl)silyl]oxy-2,6,8,8-tetramethyldecan-2-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 76605457 |
| Molecular Formula | C26H58O2Si2 |
| Molecular Weight | 458.92 g/mol |
| Exact Mass | 458.40 |
| IUPAC Name | tert-butyl-[10-[tert-butyl(dimethyl)silyl]oxy-2,6,8,8-tetramethyldecan-2-yl]oxy-dimethylsilane |
| SMILES | CC(CCCC(C)(C)O[Si](C)(C)C(C)(C)C)CC(C)(C)CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H58O2Si2/c1-22(17-16-18-26(10,11)28-30(14,15)24(5,6)7)21-25(8,9)19-20-27-29(12,13)23(2,3)4/h22H,16-21H2,1-15H3 |
| InChIKey | YCHYMNYWPGXFND-UHFFFAOYSA-N |
| XLogP | 9.42 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.92 |
| LogP ≤ 5 | 9.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|