About 6-(dimethylamino)hex-3-ene-1,5-diol
6-(dimethylamino)hex-3-ene-1,5-diol (PubChem CID 76605569) has the molecular formula C8H17NO2
and a molecular weight of 159.23 g/mol. Its IUPAC name is 6-(dimethylamino)hex-3-ene-1,5-diol.
Molecular Properties
| Compound Name | 6-(dimethylamino)hex-3-ene-1,5-diol |
| PubChem CID | 76605569 |
| Molecular Formula | C8H17NO2 |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.13 |
| IUPAC Name | 6-(dimethylamino)hex-3-ene-1,5-diol |
| SMILES | CN(C)CC(O)C=CCCO |
| InChI | InChI=1S/C8H17NO2/c1-9(2)7-8(11)5-3-4-6-10/h3,5,8,10-11H,4,6-7H2,1-2H3 |
| InChIKey | FLXWKNWPJDYEJF-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-(dimethylamino)hex-3-ene-1,5-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(dimethylamino)hex-3-ene-1,5-diol?
The IUPAC name of 6-(dimethylamino)hex-3-ene-1,5-diol (CID 76605569) is 6-(dimethylamino)hex-3-ene-1,5-diol.
What is the SMILES notation for 6-(dimethylamino)hex-3-ene-1,5-diol?
The canonical SMILES for 6-(dimethylamino)hex-3-ene-1,5-diol is CN(C)CC(O)C=CCCO.
What is the InChIKey of 6-(dimethylamino)hex-3-ene-1,5-diol?
The InChIKey is FLXWKNWPJDYEJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NO2/c1-9(2)7-8(11)5-3-4-6-10/h3,5,8,10-11H,4,6-7H2,1-2H3.
What are the key properties of 6-(dimethylamino)hex-3-ene-1,5-diol?
6-(dimethylamino)hex-3-ene-1,5-diol has a molecular weight of 159.23 g/mol, XLogP of -0.15, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(dimethylamino)hex-3-ene-1,5-diol is sourced from PubChem (CID 76605569), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).