About 4-bromo-N-[(3,4-dimethoxyphenyl)methyl]aniline
4-bromo-N-[(3,4-dimethoxyphenyl)methyl]aniline (PubChem CID 766065) has the molecular formula C15H16BrNO2
and a molecular weight of 322.20 g/mol. Its IUPAC name is 4-bromo-N-[(3,4-dimethoxyphenyl)methyl]aniline.
Molecular Properties
| Compound Name | 4-bromo-N-[(3,4-dimethoxyphenyl)methyl]aniline |
| PubChem CID | 766065 |
| Molecular Formula | C15H16BrNO2 |
| Molecular Weight | 322.20 g/mol |
| Exact Mass | 321.04 |
| IUPAC Name | 4-bromo-N-[(3,4-dimethoxyphenyl)methyl]aniline |
| SMILES | COc1ccc(CNc2ccc(Br)cc2)cc1OC |
| InChI | InChI=1S/C15H16BrNO2/c1-18-14-8-3-11(9-15(14)19-2)10-17-13-6-4-12(16)5-7-13/h3-9,17H,10H2,1-2H3 |
| InChIKey | ZGHWGISWKFMGEX-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.20 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-bromo-N-[(3,4-dimethoxyphenyl)methyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-N-[(3,4-dimethoxyphenyl)methyl]aniline?
The IUPAC name of 4-bromo-N-[(3,4-dimethoxyphenyl)methyl]aniline (CID 766065) is 4-bromo-N-[(3,4-dimethoxyphenyl)methyl]aniline.
What is the SMILES notation for 4-bromo-N-[(3,4-dimethoxyphenyl)methyl]aniline?
The canonical SMILES for 4-bromo-N-[(3,4-dimethoxyphenyl)methyl]aniline is COc1ccc(CNc2ccc(Br)cc2)cc1OC.
What is the InChIKey of 4-bromo-N-[(3,4-dimethoxyphenyl)methyl]aniline?
The InChIKey is ZGHWGISWKFMGEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16BrNO2/c1-18-14-8-3-11(9-15(14)19-2)10-17-13-6-4-12(16)5-7-13/h3-9,17H,10H2,1-2H3.
What are the key properties of 4-bromo-N-[(3,4-dimethoxyphenyl)methyl]aniline?
4-bromo-N-[(3,4-dimethoxyphenyl)methyl]aniline has a molecular weight of 322.20 g/mol, XLogP of 4.08, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-N-[(3,4-dimethoxyphenyl)methyl]aniline is sourced from PubChem (CID 766065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).