C24H23NO4S2 — CID 76606582
2-[5-[4-[2-(4-methylphenyl)ethenyl]phenyl]-1,1-dioxo-3H-thieno[2,3-d][1,2]thiazol-2-yl]butanoic acid (PubChem CID 76606582) has the molecular formula C24H23NO4S2 and a molecular weight of 453.59 g/mol. Its IUPAC name is 2-[5-[4-[2-(4-methylphenyl)ethenyl]phenyl]-1,1-dioxo-3H-thieno[2,3-d][1,2]thiazol-2-yl]butanoic acid.
| Compound Name | 2-[5-[4-[2-(4-methylphenyl)ethenyl]phenyl]-1,1-dioxo-3H-thieno[2,3-d][1,2]thiazol-2-yl]butanoic acid |
|---|---|
| PubChem CID | 76606582 |
| Molecular Formula | C24H23NO4S2 |
| Molecular Weight | 453.59 g/mol |
| Exact Mass | 453.11 |
| IUPAC Name | 2-[5-[4-[2-(4-methylphenyl)ethenyl]phenyl]-1,1-dioxo-3H-thieno[2,3-d][1,2]thiazol-2-yl]butanoic acid |
| SMILES | CCC(C(=O)O)N1Cc2sc(-c3ccc(C=Cc4ccc(C)cc4)cc3)cc2S1(=O)=O |
| InChI | InChI=1S/C24H23NO4S2/c1-3-20(24(26)27)25-15-22-23(31(25,28)29)14-21(30-22)19-12-10-18(11-13-19)9-8-17-6-4-16(2)5-7-17/h4-14,20H,3,15H2,1-2H3,(H,26,27) |
| InChIKey | NNMZKNWCIRNAPJ-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.59 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|