C26H30N2O3 — CID 76608263
2-[3a-[4-[4-(dimethylamino)phenyl]buta-1,3-dienyl]-4,4-dimethyl-1,2-dihydro-[1,3]oxazolo[3,2-a]indol-6-yl]acetic acid (PubChem CID 76608263) has the molecular formula C26H30N2O3 and a molecular weight of 418.54 g/mol. Its IUPAC name is 2-[3a-[4-[4-(dimethylamino)phenyl]buta-1,3-dienyl]-4,4-dimethyl-1,2-dihydro-[1,3]oxazolo[3,2-a]indol-6-yl]acetic acid.
| Compound Name | 2-[3a-[4-[4-(dimethylamino)phenyl]buta-1,3-dienyl]-4,4-dimethyl-1,2-dihydro-[1,3]oxazolo[3,2-a]indol-6-yl]acetic acid |
|---|---|
| PubChem CID | 76608263 |
| Molecular Formula | C26H30N2O3 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.23 |
| IUPAC Name | 2-[3a-[4-[4-(dimethylamino)phenyl]buta-1,3-dienyl]-4,4-dimethyl-1,2-dihydro-[1,3]oxazolo[3,2-a]indol-6-yl]acetic acid |
| SMILES | CN(C)c1ccc(C=CC=CC23OCCN2c2ccc(CC(=O)O)cc2C3(C)C)cc1 |
| InChI | InChI=1S/C26H30N2O3/c1-25(2)22-17-20(18-24(29)30)10-13-23(22)28-15-16-31-26(25,28)14-6-5-7-19-8-11-21(12-9-19)27(3)4/h5-14,17H,15-16,18H2,1-4H3,(H,29,30) |
| InChIKey | KJYSNQGGRGROSY-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|