C22H18F5NO2 — CID 76608265
2-[4,4-dimethyl-3a-[2-(2,3,4,5,6-pentafluorophenyl)ethenyl]-1,2-dihydro-[1,3]oxazolo[3,2-a]indol-6-yl]acetaldehyde (PubChem CID 76608265) has the molecular formula C22H18F5NO2 and a molecular weight of 423.38 g/mol. Its IUPAC name is 2-[4,4-dimethyl-3a-[2-(2,3,4,5,6-pentafluorophenyl)ethenyl]-1,2-dihydro-[1,3]oxazolo[3,2-a]indol-6-yl]acetaldehyde.
| Compound Name | 2-[4,4-dimethyl-3a-[2-(2,3,4,5,6-pentafluorophenyl)ethenyl]-1,2-dihydro-[1,3]oxazolo[3,2-a]indol-6-yl]acetaldehyde |
|---|---|
| PubChem CID | 76608265 |
| Molecular Formula | C22H18F5NO2 |
| Molecular Weight | 423.38 g/mol |
| Exact Mass | 423.13 |
| IUPAC Name | 2-[4,4-dimethyl-3a-[2-(2,3,4,5,6-pentafluorophenyl)ethenyl]-1,2-dihydro-[1,3]oxazolo[3,2-a]indol-6-yl]acetaldehyde |
| SMILES | CC1(C)c2cc(CC=O)ccc2N2CCOC21C=Cc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C22H18F5NO2/c1-21(2)14-11-12(6-9-29)3-4-15(14)28-8-10-30-22(21,28)7-5-13-16(23)18(25)20(27)19(26)17(13)24/h3-5,7,9,11H,6,8,10H2,1-2H3 |
| InChIKey | HUCNHNMXQCCSPE-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.38 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|