About 2-[(4-amino-1,2,5-oxadiazol-3-yl)iminomethyl]phenol
2-[(4-amino-1,2,5-oxadiazol-3-yl)iminomethyl]phenol (PubChem CID 766083) has the molecular formula C9H8N4O2
and a molecular weight of 204.19 g/mol. Its IUPAC name is 2-[(4-amino-1,2,5-oxadiazol-3-yl)iminomethyl]phenol.
Molecular Properties
| Compound Name | 2-[(4-amino-1,2,5-oxadiazol-3-yl)iminomethyl]phenol |
| PubChem CID | 766083 |
| Molecular Formula | C9H8N4O2 |
| Molecular Weight | 204.19 g/mol |
| Exact Mass | 204.06 |
| IUPAC Name | 2-[(4-amino-1,2,5-oxadiazol-3-yl)iminomethyl]phenol |
| SMILES | Nc1nonc1/N=C/c1ccccc1O |
| InChI | InChI=1S/C9H8N4O2/c10-8-9(13-15-12-8)11-5-6-3-1-2-4-7(6)14/h1-5,14H,(H2,10,12)/b11-5+ |
| InChIKey | QJUJBNHKYAGAIO-VZUCSPMQSA-N |
| XLogP | 1.11 |
| TPSA | 97.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.19 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[(4-amino-1,2,5-oxadiazol-3-yl)iminomethyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-amino-1,2,5-oxadiazol-3-yl)iminomethyl]phenol?
The IUPAC name of 2-[(4-amino-1,2,5-oxadiazol-3-yl)iminomethyl]phenol (CID 766083) is 2-[(4-amino-1,2,5-oxadiazol-3-yl)iminomethyl]phenol.
What is the SMILES notation for 2-[(4-amino-1,2,5-oxadiazol-3-yl)iminomethyl]phenol?
The canonical SMILES for 2-[(4-amino-1,2,5-oxadiazol-3-yl)iminomethyl]phenol is Nc1nonc1/N=C/c1ccccc1O.
What is the InChIKey of 2-[(4-amino-1,2,5-oxadiazol-3-yl)iminomethyl]phenol?
The InChIKey is QJUJBNHKYAGAIO-VZUCSPMQSA-N. The full InChI is InChI=1S/C9H8N4O2/c10-8-9(13-15-12-8)11-5-6-3-1-2-4-7(6)14/h1-5,14H,(H2,10,12)/b11-5+.
What are the key properties of 2-[(4-amino-1,2,5-oxadiazol-3-yl)iminomethyl]phenol?
2-[(4-amino-1,2,5-oxadiazol-3-yl)iminomethyl]phenol has a molecular weight of 204.19 g/mol, XLogP of 1.11, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-amino-1,2,5-oxadiazol-3-yl)iminomethyl]phenol is sourced from PubChem (CID 766083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).