C31H23BrN2O3S2 — CID 76609085
5-[[2-[(2-bromophenyl)methoxy]-4-(2-carbazol-9-ylethoxy)phenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 76609085) has the molecular formula C31H23BrN2O3S2 and a molecular weight of 615.57 g/mol. Its IUPAC name is 5-[[2-[(2-bromophenyl)methoxy]-4-(2-carbazol-9-ylethoxy)phenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 5-[[2-[(2-bromophenyl)methoxy]-4-(2-carbazol-9-ylethoxy)phenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 76609085 |
| Molecular Formula | C31H23BrN2O3S2 |
| Molecular Weight | 615.57 g/mol |
| Exact Mass | 614.03 |
| IUPAC Name | 5-[[2-[(2-bromophenyl)methoxy]-4-(2-carbazol-9-ylethoxy)phenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | O=C1NC(=S)SC1=Cc1ccc(OCCn2c3ccccc3c3ccccc32)cc1OCc1ccccc1Br |
| InChI | InChI=1S/C31H23BrN2O3S2/c32-25-10-4-1-7-21(25)19-37-28-18-22(14-13-20(28)17-29-30(35)33-31(38)39-29)36-16-15-34-26-11-5-2-8-23(26)24-9-3-6-12-27(24)34/h1-14,17-18H,15-16,19H2,(H,33,35,38) |
| InChIKey | UNPCWBJBWXIARI-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.57 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|