C29H27BrN4O4 — CID 76613352
tert-butyl N-[1-[4-(8-bromoimidazo[1,2-a]pyridin-2-yl)phenyl]-3-(1,3-dioxoisoindol-2-yl)propan-2-yl]carbamate (PubChem CID 76613352) has the molecular formula C29H27BrN4O4 and a molecular weight of 575.46 g/mol. Its IUPAC name is tert-butyl N-[1-[4-(8-bromoimidazo[1,2-a]pyridin-2-yl)phenyl]-3-(1,3-dioxoisoindol-2-yl)propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[4-(8-bromoimidazo[1,2-a]pyridin-2-yl)phenyl]-3-(1,3-dioxoisoindol-2-yl)propan-2-yl]carbamate |
|---|---|
| PubChem CID | 76613352 |
| Molecular Formula | C29H27BrN4O4 |
| Molecular Weight | 575.46 g/mol |
| Exact Mass | 574.12 |
| IUPAC Name | tert-butyl N-[1-[4-(8-bromoimidazo[1,2-a]pyridin-2-yl)phenyl]-3-(1,3-dioxoisoindol-2-yl)propan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(Cc1ccc(-c2cn3cccc(Br)c3n2)cc1)CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C29H27BrN4O4/c1-29(2,3)38-28(37)31-20(16-34-26(35)21-7-4-5-8-22(21)27(34)36)15-18-10-12-19(13-11-18)24-17-33-14-6-9-23(30)25(33)32-24/h4-14,17,20H,15-16H2,1-3H3,(H,31,37) |
| InChIKey | AJOQCKKKNGXKFE-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 93.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.46 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|