C25H22ClIN2O2 — CID 76613782
N-(4-chlorophenyl)-N-[1-(4-iodobenzoyl)-2-methyl-3,4-dihydro-2H-quinolin-4-yl]acetamide (PubChem CID 76613782) has the molecular formula C25H22ClIN2O2 and a molecular weight of 544.82 g/mol. Its IUPAC name is N-(4-chlorophenyl)-N-[1-(4-iodobenzoyl)-2-methyl-3,4-dihydro-2H-quinolin-4-yl]acetamide.
| Compound Name | N-(4-chlorophenyl)-N-[1-(4-iodobenzoyl)-2-methyl-3,4-dihydro-2H-quinolin-4-yl]acetamide |
|---|---|
| PubChem CID | 76613782 |
| Molecular Formula | C25H22ClIN2O2 |
| Molecular Weight | 544.82 g/mol |
| Exact Mass | 544.04 |
| IUPAC Name | N-(4-chlorophenyl)-N-[1-(4-iodobenzoyl)-2-methyl-3,4-dihydro-2H-quinolin-4-yl]acetamide |
| SMILES | CC(=O)N(c1ccc(Cl)cc1)C1CC(C)N(C(=O)c2ccc(I)cc2)c2ccccc21 |
| InChI | InChI=1S/C25H22ClIN2O2/c1-16-15-24(29(17(2)30)21-13-9-19(26)10-14-21)22-5-3-4-6-23(22)28(16)25(31)18-7-11-20(27)12-8-18/h3-14,16,24H,15H2,1-2H3 |
| InChIKey | XVRUYKMGNKYERU-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.82 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|