C30H34F2N2O — CID 76614153
N-(1-benzylpyrrolidin-3-yl)-6,6-bis(4-fluorophenyl)-N-methylhexanamide (PubChem CID 76614153) has the molecular formula C30H34F2N2O and a molecular weight of 476.61 g/mol. Its IUPAC name is N-(1-benzylpyrrolidin-3-yl)-6,6-bis(4-fluorophenyl)-N-methylhexanamide.
| Compound Name | N-(1-benzylpyrrolidin-3-yl)-6,6-bis(4-fluorophenyl)-N-methylhexanamide |
|---|---|
| PubChem CID | 76614153 |
| Molecular Formula | C30H34F2N2O |
| Molecular Weight | 476.61 g/mol |
| Exact Mass | 476.26 |
| IUPAC Name | N-(1-benzylpyrrolidin-3-yl)-6,6-bis(4-fluorophenyl)-N-methylhexanamide |
| SMILES | CN(C(=O)CCCCC(c1ccc(F)cc1)c1ccc(F)cc1)C1CCN(Cc2ccccc2)C1 |
| InChI | InChI=1S/C30H34F2N2O/c1-33(28-19-20-34(22-28)21-23-7-3-2-4-8-23)30(35)10-6-5-9-29(24-11-15-26(31)16-12-24)25-13-17-27(32)18-14-25/h2-4,7-8,11-18,28-29H,5-6,9-10,19-22H2,1H3 |
| InChIKey | MPWQAJXJUKICEI-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.61 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|