C35H55N5O6S — CID 76618106
4-[[2-[(2-benzyl-3-tert-butylsulfonylpropanoyl)amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-N-butyl-5-cyclohexyl-2-hydroxypentanamide (PubChem CID 76618106) has the molecular formula C35H55N5O6S and a molecular weight of 673.92 g/mol. Its IUPAC name is 4-[[2-[(2-benzyl-3-tert-butylsulfonylpropanoyl)amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-N-butyl-5-cyclohexyl-2-hydroxypentanamide.
| Compound Name | 4-[[2-[(2-benzyl-3-tert-butylsulfonylpropanoyl)amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-N-butyl-5-cyclohexyl-2-hydroxypentanamide |
|---|---|
| PubChem CID | 76618106 |
| Molecular Formula | C35H55N5O6S |
| Molecular Weight | 673.92 g/mol |
| Exact Mass | 673.39 |
| IUPAC Name | 4-[[2-[(2-benzyl-3-tert-butylsulfonylpropanoyl)amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-N-butyl-5-cyclohexyl-2-hydroxypentanamide |
| SMILES | CCCCNC(=O)C(O)CC(CC1CCCCC1)NC(=O)C(Cc1cnc[nH]1)NC(=O)C(Cc1ccccc1)CS(=O)(=O)C(C)(C)C |
| InChI | InChI=1S/C35H55N5O6S/c1-5-6-17-37-34(44)31(41)21-28(19-26-15-11-8-12-16-26)39-33(43)30(20-29-22-36-24-38-29)40-32(42)27(18-25-13-9-7-10-14-25)23-47(45,46)35(2,3)4/h7,9-10,13-14,22,24,26-28,30-31,41H,5-6,8,11-12,15-21,23H2,1-4H3,(H,36,38)(H,37,44)(H,39,43)(H,40,42) |
| InChIKey | HNPQBTJNDISSBF-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 170.35 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.92 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|