About 10-benzyl-1,4,7-trioxa-10-azacyclododecane
10-benzyl-1,4,7-trioxa-10-azacyclododecane (PubChem CID 766194) has the molecular formula C15H23NO3
and a molecular weight of 265.35 g/mol. Its IUPAC name is 10-benzyl-1,4,7-trioxa-10-azacyclododecane.
Molecular Properties
| Compound Name | 10-benzyl-1,4,7-trioxa-10-azacyclododecane |
| PubChem CID | 766194 |
| Molecular Formula | C15H23NO3 |
| Molecular Weight | 265.35 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | 10-benzyl-1,4,7-trioxa-10-azacyclododecane |
| SMILES | c1ccc(CN2CCOCCOCCOCC2)cc1 |
| InChI | InChI=1S/C15H23NO3/c1-2-4-15(5-3-1)14-16-6-8-17-10-12-19-13-11-18-9-7-16/h1-5H,6-14H2 |
| InChIKey | JPSAXKRUQAICFV-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.35 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 10-benzyl-1,4,7-trioxa-10-azacyclododecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-benzyl-1,4,7-trioxa-10-azacyclododecane?
The IUPAC name of 10-benzyl-1,4,7-trioxa-10-azacyclododecane (CID 766194) is 10-benzyl-1,4,7-trioxa-10-azacyclododecane.
What is the SMILES notation for 10-benzyl-1,4,7-trioxa-10-azacyclododecane?
The canonical SMILES for 10-benzyl-1,4,7-trioxa-10-azacyclododecane is c1ccc(CN2CCOCCOCCOCC2)cc1.
What is the InChIKey of 10-benzyl-1,4,7-trioxa-10-azacyclododecane?
The InChIKey is JPSAXKRUQAICFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23NO3/c1-2-4-15(5-3-1)14-16-6-8-17-10-12-19-13-11-18-9-7-16/h1-5H,6-14H2.
What are the key properties of 10-benzyl-1,4,7-trioxa-10-azacyclododecane?
10-benzyl-1,4,7-trioxa-10-azacyclododecane has a molecular weight of 265.35 g/mol, XLogP of 1.55, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 10-benzyl-1,4,7-trioxa-10-azacyclododecane is sourced from PubChem (CID 766194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).