C16H25N2O+ — CID 7661953
3-[[(1R,9aS)-1,2,3,4,5,6,7,8,9,9a-decahydroquinolizin-5-ium-1-yl]methoxy]aniline (PubChem CID 7661953) has the molecular formula C16H25N2O+ and a molecular weight of 261.39 g/mol. Its IUPAC name is 3-[[(1R,9aS)-1,2,3,4,5,6,7,8,9,9a-decahydroquinolizin-5-ium-1-yl]methoxy]aniline.
| Compound Name | 3-[[(1R,9aS)-1,2,3,4,5,6,7,8,9,9a-decahydroquinolizin-5-ium-1-yl]methoxy]aniline |
|---|---|
| PubChem CID | 7661953 |
| Molecular Formula | C16H25N2O+ |
| Molecular Weight | 261.39 g/mol |
| Exact Mass | 261.20 |
| IUPAC Name | 3-[[(1R,9aS)-1,2,3,4,5,6,7,8,9,9a-decahydroquinolizin-5-ium-1-yl]methoxy]aniline |
| SMILES | Nc1cccc(OC[C@@H]2CCC[NH+]3CCCC[C@@H]23)c1 |
| InChI | InChI=1S/C16H24N2O/c17-14-6-3-7-15(11-14)19-12-13-5-4-10-18-9-2-1-8-16(13)18/h3,6-7,11,13,16H,1-2,4-5,8-10,12,17H2/p+1/t13-,16-/m0/s1 |
| InChIKey | HDXSSQBGRXLIOW-BBRMVZONSA-O |
| XLogP | 1.50 |
| TPSA | 39.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.39 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|